/********************************************************************** residue.cpp - Unit tests for Open Babel OBResidue class Copyright (C) 2005-2006 Geoffrey R. Hutchison This file is part of the Open Babel project. For more information, see This program is free software; you can redistribute it and/or modify it under the terms of the GNU General Public License as published by the Free Software Foundation version 2 of the License. This program is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. ***********************************************************************/ // used to set import/export for Cygwin DLLs #ifdef WIN32 #define USING_OBDLL #endif #include #include #include #include #include using namespace std; using namespace OpenBabel; // helper functions for chains parsing void CheckValidResidue(OBConversion &conv, const string &test, unsigned int testCount); void CheckInvalidResidue(OBConversion &conv, const string &test, unsigned int testCount); void CheckValidDipeptide(OBConversion &conv, const string &test, unsigned int testCount); int main(int argc,char *argv[]) { // turn off slow sync with C-style output (we don't use it anyway). std::ios::sync_with_stdio(false); if (argc != 1) { cout << "Usage: residue" << endl; cout << " Unit tests for OBResidue " << endl; return(-1); } cout << "# Unit tests for OBResidue \n"; cout << "ok 1\n"; // for loading tests // OBResidue isolation tests OBResidue emptyResidue, testRes1; cout << "ok 2\n"; // ctor works // chains parser tests // PR#1515198 static const string loopTest1("C1(C(NC(C(N1C(C(NC(C=Cc1ccccc1)=O)C)=O)Cc1ccccc1)=O)Cc1ccccc1)=O"); OBConversion conv; OBMol mol; OBFormat *inFormat = conv.FindFormat("SMI"); conv.SetInFormat(inFormat); conv.ReadString(&mol, loopTest1); chainsparser.PerceiveChains(mol); // OK if it doesn't crash cout << "ok 3\n"; // parse common residues unsigned int testCount = 3; static const string ala("NC(C)C(O)(=O)"); CheckValidResidue(conv, ala, ++testCount); static const string arg("NC(CCCNC(N)=N)C(O)(=O)"); CheckValidResidue(conv, arg, ++testCount); static const string asn("NC(CC(N)=O)C(O)(=O)"); CheckValidResidue(conv, asn, ++testCount); static const string asp("NC(CC(O)=O)C(O)(=O)"); CheckValidResidue(conv, asp, ++testCount); static const string cys("NC(CS)C(O)(=O)"); CheckValidResidue(conv, cys, ++testCount); static const string glu("NC(CCC(O)=O)C(O)(=O)"); CheckValidResidue(conv, glu, ++testCount); static const string gln("NC(CCC(N)=O)C(O)(=O)"); CheckValidResidue(conv, gln, ++testCount); static const string gly("NC([H])C(O)(=O)"); CheckValidResidue(conv, gly, ++testCount); static const string his("NC(CC1=CNC=N1)C(O)(=O)"); CheckValidResidue(conv, his, ++testCount); static const string ile("NC(C(CC)C)C(O)(=O)"); CheckValidResidue(conv, ile, ++testCount); static const string leu("NC(CC(C)C)C(O)(=O)"); CheckValidResidue(conv, leu, ++testCount); static const string lys("NC(CCCCN)C(O)(=O)"); CheckValidResidue(conv, lys, ++testCount); static const string met("NC(CCSC)C(O)(=O)"); CheckValidResidue(conv, met, ++testCount); static const string phe("NC(CC1=CC=CC=C1)C(O)(=O)"); CheckValidResidue(conv, phe, ++testCount); static const string pro("OC(C1CCCN1)(=O)"); CheckValidResidue(conv, pro, ++testCount); static const string ser("NC(CO)C(O)(=O)"); CheckValidResidue(conv, ser, ++testCount); static const string thr("NC(C(C)O)C(O)(=O)"); CheckValidResidue(conv, thr, ++testCount); static const string trp("NC(CC1=CNC2=C1C=CC=C2)C(O)(=O)"); CheckValidResidue(conv, trp, ++testCount); static const string tyr("NC(CC1=CC=C(O)C=C1)C(O)(=O)"); CheckValidResidue(conv, tyr, ++testCount); static const string val("NC(C(C)C)C(O)(=O)"); CheckValidResidue(conv, val, ++testCount); // nucleics static const string a("OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c(ncnc12)N"); CheckValidResidue(conv, a, ++testCount); static const string g("OC[C@H]1O[C@H](C[C@@H]1O)n1c(nc(cc1)N)=O"); CheckValidResidue(conv, g, ++testCount); static const string c("OC[C@H]1O[C@H](C[C@@H]1O)n1cnc2c([nH]c(nc12)N)=O"); CheckValidResidue(conv, c, ++testCount); static const string t("OC[C@H]1O[C@H](C[C@@H]1O)n1c([nH]c(c(c1)C)=O)=O"); CheckValidResidue(conv, t, ++testCount); static const string u("OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1c([nH]c(cc1)=O)=O"); CheckValidResidue(conv, u, ++testCount); // invalid residues static const string benzene("c1ccccc1"); CheckInvalidResidue(conv, benzene, ++testCount); static const string pyrrole("c1cccn[H]1"); CheckInvalidResidue(conv, pyrrole, ++testCount); static const string amine("CC(=O)CCN"); CheckInvalidResidue(conv, amine, ++testCount); // check some dipeptides string test = ala + val; CheckValidDipeptide(conv, test, ++testCount); test = cys + leu; CheckValidDipeptide(conv, test, ++testCount); // the number of tests for "prove" cout << "1.." << testCount << "\n"; return(0); } void CheckValidResidue(OBConversion &conv, const string &test, unsigned int testCount) { OBMol mol; mol.Clear(); conv.ReadString(&mol, test); chainsparser.PerceiveChains(mol); if (mol.NumResidues() != 1) { cout << "not ok " << testCount << " # expected 1 residue, but found " << mol.NumResidues() << '\n'; cout << "# "; FOR_RESIDUES_OF_MOL(res, mol) cout << res->GetName() << " "; cout << endl; } else { OBResidue *res; res = mol.GetResidue(0); cout << "ok " << testCount << " # " << res->GetName() << endl; } } void CheckInvalidResidue(OBConversion &conv, const string &test, unsigned int testCount) { OBMol mol; mol.Clear(); conv.ReadString(&mol, test); chainsparser.PerceiveChains(mol); if (mol.NumResidues() != 0) { OBResidue *res = mol.GetResidue(0); if (res->GetName() == "LIG") { // ligand, not residue cout << "ok " << testCount << " # found ligand, not residue " << test << '\n'; } else { cout << "not ok " << testCount << " # expected 0 residues, found " << mol.NumResidues() << '\n'; cout << "# " << res->GetName() << endl; } } else cout << "ok " << testCount << " # correctly rejected " << test << '\n'; } void CheckValidDipeptide(OBConversion &conv, const string &test, unsigned int testCount) { OBMol mol; OBResidue *res; mol.Clear(); conv.ReadString(&mol, test); chainsparser.PerceiveChains(mol); if (mol.NumResidues() != 2) { cout << "not ok " << testCount << " # expected 2 residues, but found " << mol.NumResidues() << '\n'; cout << "# "; FOR_RESIDUES_OF_MOL(res, mol) cout << res->GetName() << " "; cout << endl; } else { res = mol.GetResidue(0); cout << "ok " << testCount << " # " << res->GetName(); res = mol.GetResidue(1); cout << " " << res->GetName() << '\n'; } }